CAS 110851-65-5
:Thiophene, 3-decyl-, homopolymer
Description:
Thiophene, 3-decyl-, homopolymer, identified by the CAS number 110851-65-5, is a synthetic polymer derived from the polymerization of 3-decylthiophene monomers. This compound exhibits characteristics typical of thiophene-based polymers, including good electrical conductivity, thermal stability, and solubility in organic solvents. The presence of the decyl side chain enhances its solubility and processability, making it suitable for applications in organic electronics, such as organic photovoltaics and field-effect transistors. The polymer's conjugated structure contributes to its electronic properties, allowing for effective charge transport. Additionally, thiophene polymers are known for their mechanical flexibility and can be processed into thin films. The material's properties can be further tailored through copolymerization or by modifying the side chains, which can influence its crystallinity, morphology, and overall performance in various applications. Overall, thiophene, 3-decyl-, homopolymer represents a versatile material in the field of organic semiconductors.
Formula:(C14H24S)x
InChI:InChI=1S/C14H24S/c1-2-3-4-5-6-7-8-9-10-14-11-12-15-13-14/h11-13H,2-10H2,1H3
InChI key:InChIKey=JAYBIBLZTQMCAY-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)C=1C=CSC1
Synonyms:- Poly(3-decylthiophene)
- Thiophene, 3-decyl-, homopolymer
- 3-Decylthiophene homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
