CAS 110859-69-3
:4-methyl-2-(methylamino)-1,3-thiazole-5-carboxylic acid
Description:
4-Methyl-2-(methylamino)-1,3-thiazole-5-carboxylic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a methylamino group, which can influence its reactivity and solubility. The presence of the methyl group on the thiazole ring enhances its lipophilicity, potentially affecting its biological activity. This compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where thiazole derivatives are known for their diverse biological activities, including antimicrobial and anti-inflammatory effects. Its molecular structure allows for various interactions with biological targets, making it a subject of interest in drug development. Additionally, the compound's stability, solubility in polar solvents, and potential for forming salts are important characteristics that can influence its application in pharmaceuticals.
Formula:C6H8N2O2S
InChI:InChI=1/C6H8N2O2S/c1-3-4(5(9)10)11-6(7-2)8-3/h1-2H3,(H,7,8)(H,9,10)
Synonyms:- 5-Thiazolecarboxylic acid, 4-methyl-2-(methylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Methyl-2-(methylamino)-1,3-thiazole-5-carboxylic acid
CAS:Formula:C6H8N2O2SColor and Shape:SolidMolecular weight:172.2049
