CAS 110862-47-0
:Methyl 2-(4-fluorophenyl)-δ-hydroxy-5-(1-methylethyl)-β-oxo-3-phenyl-4-[(phenylamino)carbonyl]-1H-pyrrole-1-heptanoate
Description:
Methyl 2-(4-fluorophenyl)-δ-hydroxy-5-(1-methylethyl)-β-oxo-3-phenyl-4-[(phenylamino)carbonyl]-1H-pyrrole-1-heptanoate, with CAS number 110862-47-0, is a complex organic compound characterized by its intricate molecular structure, which includes a pyrrole ring and various functional groups such as esters, ketones, and amides. This compound exhibits properties typical of pyrrole derivatives, including potential biological activity due to the presence of the fluorophenyl and phenylamino substituents, which may influence its pharmacological profile. The presence of the hydroxy and carbonyl groups suggests it may engage in hydrogen bonding, affecting its solubility and reactivity. Additionally, the isopropyl group contributes to its steric bulk, which can impact its interaction with biological targets. Overall, this compound's unique structure may confer specific chemical reactivity and biological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its characteristics and potential applications.
Formula:C34H35FN2O5
InChI:InChI=1S/C34H35FN2O5/c1-22(2)32-31(34(41)36-26-12-8-5-9-13-26)30(23-10-6-4-7-11-23)33(24-14-16-25(35)17-15-24)37(32)19-18-27(38)20-28(39)21-29(40)42-3/h4-17,22,27,38H,18-21H2,1-3H3,(H,36,41)
InChI key:InChIKey=RDXZJVLAFDSGAS-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C=2C(=C(N(CCC(CC(CC(OC)=O)=O)O)C2C(C)C)C3=CC=C(F)C=C3)C4=CC=CC=C4
Synonyms:- Methyl 2-(4-fluorophenyl)-δ-hydroxy-5-(1-methylethyl)-β-oxo-3-phenyl-4-[(phenylamino)carbonyl]-1H-pyrrole-1-heptanoate
- 1H-Pyrrole-1-heptanoic acid, 2-(4-fluorophenyl)-δ-hydroxy-5-(1-methylethyl)-β-oxo-3-phenyl-4-[(phenylamino)carbonyl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
