CAS 110863-33-7
:neurokinin A (4-10), Nle(10)-
Description:
Neurokinin A (4-10), Nle(10)- is a synthetic peptide that is a derivative of neurokinin A, a neuropeptide involved in various physiological processes, including pain perception, inflammation, and the regulation of smooth muscle contraction. This specific peptide is characterized by its sequence, which includes a substitution of norleucine (Nle) at the tenth position, enhancing its stability and biological activity compared to the native form. The CAS number 110863-33-7 uniquely identifies this compound in chemical databases. Neurokinin A (4-10), Nle(10)- exhibits properties typical of peptides, such as solubility in water and potential bioactivity, making it of interest in pharmacological research, particularly in the context of neurogenic inflammation and respiratory disorders. Its structure allows it to interact with neurokinin receptors, which are part of the G-protein coupled receptor family, influencing various signaling pathways. Overall, this compound serves as a valuable tool in understanding neurokinin signaling and developing therapeutic agents targeting related pathways.
Formula:C35H56N8O10
InChI:InChI=1/C35H56N8O10/c1-6-7-13-23(30(37)48)40-32(50)24(14-19(2)3)39-27(45)17-38-35(53)29(20(4)5)43-33(51)25(15-21-11-9-8-10-12-21)41-34(52)26(18-44)42-31(49)22(36)16-28(46)47/h8-12,19-20,22-26,29,44H,6-7,13-18,36H2,1-5H3,(H2,37,48)(H,38,53)(H,39,45)(H,40,50)(H,41,52)(H,42,49)(H,43,51)(H,46,47)/t22-,23-,24-,25-,26-,29-/m0/s1
SMILES:CCCC[C@@H](C(=N)O)N=C([C@H](CC(C)C)N=C(CN=C([C@H](C(C)C)N=C([C@H](Cc1ccccc1)N=C([C@H](CO)N=C([C@H](CC(=O)O)N)O)O)O)O)O)O
Synonyms:- 10-Nle-neurokinin A (4-10)
- Neurokinin A (4-10), norleucine(10)-
- Nle(10)-nka(4-10)
- L-Norleucinamide-L-alpha-aspartyl-L-seryl-L-phenylalanyl-L-valylglycyl-L-leucyl-
- L-alpha-aspartyl-L-seryl-L-phenylalanyl-L-valylglycyl-L-leucyl-L-norleucinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Neurokinin A (4-10), nle(10)-
CAS:Neurokinin A (4-10), nle(10)-, a peptide from the pre-protachykinin gene, excites mammalian nerves and impacts inflammation and pain.Formula:C35H56N8O10Color and Shape:SolidMolecular weight:748.87(Nle 10)-Neurokinin A (4-10)
CAS:Please enquire for more information about (Nle 10)-Neurokinin A (4-10) including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C35H56N8O10Purity:Min. 95%Molecular weight:748.87 g/mol

