CymitQuimica logo

CAS 110864-93-2

:

1-((1,2,3,4)-2-Fluoro-3-hydroxy-4-( hydroxymethyl)cyclopentyl)-5-iodo- 2,4(1H,3H)-pyrimidinedione

Description:
1-((1,2,3,4)-2-Fluoro-3-hydroxy-4-(hydroxymethyl)cyclopentyl)-5-iodo-2,4(1H,3H)-pyrimidinedione, with the CAS number 110864-93-2, is a chemical compound characterized by its complex structure, which includes a pyrimidinedione core and a cyclopentyl moiety. The presence of a fluorine atom and multiple hydroxyl groups contributes to its potential biological activity and solubility properties. This compound may exhibit unique pharmacological effects due to the specific arrangement of functional groups, which can influence its interaction with biological targets. The iodine substituent can enhance the compound's lipophilicity and may play a role in its reactivity and stability. As a pyrimidinedione derivative, it may be of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, mass spectrometry, and chromatography.
Formula:C10H12FIN2O4
InChI:InChI=1/C10H12FIN2O4/c11-7-6(1-4(3-15)8(7)16)14-2-5(12)9(17)13-10(14)18/h2,4,6-8,15-16H,1,3H2,(H,13,17,18)
SMILES:C1C(CO)C(C(C1n1cc(c(nc1=O)O)I)F)O
Synonyms:
  • C-Fiau
  • 2,4(1H,3H)-Pyrimidinedione, 1-(2-fluoro-3-hydroxy-4-(hydroxymethyl)cyclopentyl)-5-iodo-, (1alpha,2alpha,3beta,4alpha)-(+-)-
  • 1-[2-fluoro-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-5-iodopyrimidine-2,4(1H,3H)-dione
  • 1-((1,2,3,4)-2-Fluoro-3-hydroxy-4-( hydroxymethyl)cyclopentyl)-5-iodo-2,4(1H,3H)-pyrimidinedione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.