CymitQuimica logo

CAS 110871-35-7

:

N-benzyl-3-methylbutan-2-amine

Description:
N-benzyl-3-methylbutan-2-amine is an organic compound characterized by its amine functional group, which is attached to a branched alkyl chain. This substance features a benzyl group, contributing to its aromatic properties, and a 3-methylbutan-2-amine backbone, indicating the presence of a secondary amine due to the nitrogen atom being bonded to two carbon atoms. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the benzyl group may enhance its lipophilicity, influencing its solubility in organic solvents. Additionally, N-benzyl-3-methylbutan-2-amine may exhibit biological activity, making it of interest in medicinal chemistry. As with many amines, it may have basic properties and can participate in various chemical reactions, including alkylation and acylation. Proper handling and safety measures should be observed due to potential toxicity and reactivity.
Formula:C12H19N
InChI:InChI=1/C12H19N/c1-10(2)11(3)13-9-12-7-5-4-6-8-12/h4-8,10-11,13H,9H2,1-3H3
SMILES:CC(C)C(C)NCc1ccccc1
Synonyms:
  • benzenemethanamine, N-(1,2-dimethylpropyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.