CAS 110871-36-8
:N-(1,1-Dimethyl-2-phenylethyl)-4-methylbenzenesulfonamide
Description:
N-(1,1-Dimethyl-2-phenylethyl)-4-methylbenzenesulfonamide, with the CAS number 110871-36-8, is a chemical compound characterized by its sulfonamide functional group, which is known for its applications in medicinal chemistry, particularly as antibacterial agents. This compound features a complex structure that includes a sulfonamide moiety attached to a phenyl group and a dimethyl-substituted ethyl group, contributing to its unique properties. The presence of the 4-methyl group on the benzene ring enhances its lipophilicity, potentially influencing its biological activity and solubility. The steric hindrance introduced by the dimethyl groups may also affect its interaction with biological targets. As a sulfonamide, it may exhibit properties such as antibacterial activity, though specific biological activities would depend on further empirical studies. Overall, this compound's structural characteristics suggest potential utility in pharmaceutical applications, warranting further investigation into its efficacy and safety profiles.
Formula:C17H21NO2S
InChI:InChI=1S/C17H21NO2S/c1-14-9-11-16(12-10-14)21(19,20)18-17(2,3)13-15-7-5-4-6-8-15/h4-12,18H,13H2,1-3H3
InChI key:InChIKey=UVHCLBHHPPPICF-UHFFFAOYSA-N
SMILES:S(NC(CC1=CC=CC=C1)(C)C)(=O)(=O)C2=CC=C(C)C=C2
Synonyms:- N-(1,1-Dimethyl-2-phenylethyl)-4-methylbenzenesulfonamide
- Benzenesulfonamide, N-(1,1-dimethyl-2-phenylethyl)-4-methyl-
- N-(1,1-Dimethyl-2-phenylethyl)-4-methyl-benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.