CAS 1108726-00-6

5-(1-Methylethyl)-3-pyridinemethanamine

Description:

5-(1-Methylethyl)-3-pyridinemethanamine, identified by its CAS number 1108726-00-6, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a branched alkyl group, specifically an isopropyl group (1-methylethyl), attached to the pyridine ring, along with an amine functional group (-NH2) that contributes to its basicity and potential reactivity. The presence of the amine group suggests that it may participate in hydrogen bonding and can act as a nucleophile in various chemical reactions. The compound's structure indicates it may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, but generally, pyridine derivatives are known for their moderate polarity and ability to engage in diverse chemical interactions. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₉H₁₄N₂

InChI: InChI=1S/C9H14N2/c1-7(2)9-3-8(4-10)5-11-6-9/h3,5-7H,4,10H2,1-2H3

InChI key: InChIKey=YKTPXEUDCIGWID-UHFFFAOYSA-N

SMILES: C(C)(C)C=1C=C(CN)C=NC1

Synonyms:

• [5-(Propan-2-yl)pyridin-3-yl]methanamine
• 3-Pyridinemethanamine, 5-(1-methylethyl)-
• 5-(1-Methylethyl)-3-pyridinemethanamine
• (5-Isopropylpyridin-3-yl)methanamine