CAS 110874-21-0
:2-(Methoxymethoxy)-1,3-propanediyl Dibenzoate
Description:
2-(Methoxymethoxy)-1,3-propanediyl dibenzoate, with the CAS number 110874-21-0, is an organic compound characterized by its ester functional groups and methoxy substituents. This compound features a central propanediol backbone, which is substituted at one end with two benzoate groups, contributing to its aromatic properties. The methoxymethoxy groups enhance its solubility in organic solvents and may influence its reactivity and stability. Typically, compounds of this nature are utilized in various applications, including as intermediates in organic synthesis, in the formulation of polymers, or as additives in materials science. The presence of both methoxy and benzoate functionalities suggests potential uses in the development of specialty chemicals or as plasticizers. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall structure. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C19H20O6
InChI:InChI=1/C19H20O6/c1-22-14-25-17(12-23-18(20)15-8-4-2-5-9-15)13-24-19(21)16-10-6-3-7-11-16/h2-11,17H,12-14H2,1H3
SMILES:COCOC(COC(=O)c1ccccc1)COC(=O)c1ccccc1
Synonyms:- 2-(Methoxymethoxy)-1,3-propanediol Dibenzoat
- 2-(Methoxymethoxy)-1,3-propanediol Dibenzoate
- 2-(Methoxymethoxy)Propane-1,3-Diyl Dibenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.