CAS 1108750-59-9

Poly(oxy-1,2-ethanediyl), α-(2-azidoethyl)-ω-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy]-

Description:

Poly(oxy-1,2-ethanediyl), α-(2-azidoethyl)-ω-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy]- is a complex polymeric compound characterized by its unique functional groups and structural features. This substance contains poly(ethylene glycol) segments, which contribute to its hydrophilicity and biocompatibility, making it suitable for various applications in biomedical fields. The presence of azido groups suggests potential for click chemistry reactions, allowing for further functionalization or conjugation with other molecules. Additionally, the inclusion of a pyrrolidinyl moiety indicates potential reactivity and stability under certain conditions, which may enhance its utility in drug delivery systems or as a polymeric scaffold. The overall structure implies a balance between hydrophilic and hydrophobic characteristics, which can influence solubility and interaction with biological systems. Due to its complex nature, this compound may exhibit interesting properties such as controlled release, targeted delivery, and enhanced stability, making it a subject of interest in polymer chemistry and materials science.

Formula: (C₂H₄O)nC₉H₁₂N₄O₅

InChI: InChI=1S/C11H16N4O6/c12-14-13-4-6-20-8-7-19-5-3-11(18)21-15-9(16)1-2-10(15)17/h1-8H2

InChI key: InChIKey=XDXWXTIRKQZRNN-UHFFFAOYSA-N

SMILES: O(C(CCOCCOCCN=[N+]=[N-])=O)N1C(=O)CCC1=O

Synonyms:

• Poly(oxy-1,2-ethanediyl), α-(2-azidoethyl)-ω-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy]-

Poly(oxy-1,2-ethanediyl), α-(2-azidoethyl)-ω-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy]-

CAS: 1108750-59-9

Formula: C₁₁H₁₆N₄O₆

Purity: 95%

Color and Shape: Liquid

Molecular weight: 300.2679

Ref: IN-DA001VME

Azido-dPEG® 12-NHS ester

CAS: 1108750-59-9

Azido-dPEG® 12-NHS ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Azido-dPEG® 12-NHS ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Purity: Min. 95%

Molecular weight: 740.79 g/mol

Ref: 3D-DPG-5770

TFP-dPEG®4-( m-dPEG®24)3-Ester

CAS: 1108750-59-9

TFP-dPEG®4-( m-dPEG®24)3-Ester is a research tool that can be used as an activator or ligand for cell biology, antibody characterization, ion channels, and protein interactions. This product may also be used in pharmacology and peptide synthesis. TFP-dPEG®4-( m-dPEG®24)3-Ester is also an inhibitor of CAS No. 1108750-59-9.

Formula: C₃₁H₅₆N₄O₁₆

Purity: Min. 95%

Molecular weight: 740.79 g/mol

Ref: 3D-DPG-6317