CAS 1109-28-0: O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranose
Description:The chemical substance known as O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranose, with the CAS number 1109-28-0, is a type of oligosaccharide composed of multiple glucose units linked by glycosidic bonds. Specifically, it features a repeating structure of α-D-glucopyranosyl units connected through (1→4) linkages, which is characteristic of certain polysaccharides. This compound is a derivative of starch or cellulose, exhibiting properties such as solubility in water and the ability to form gels or viscous solutions, depending on concentration and temperature. It plays a role in biological systems, serving as an energy source and participating in various metabolic processes. The oligosaccharide's structure influences its digestibility and functionality in food and pharmaceutical applications. Additionally, it may exhibit sweetness and contribute to the texture and stability of products. Overall, this compound is significant in both natural and industrial contexts, reflecting the diverse roles of carbohydrates in chemistry and biology.
Formula:C18H32O16
InChI:InChI=1S/C18H32O16/c19-1-5(23)9(25)15(6(24)2-20)33-18-14(30)12(28)16(8(4-22)32-18)34-17-13(29)11(27)10(26)7(3-21)31-17/h1,5-18,20-30H,2-4H2/t5-,6+,7+,8+,9+,10+,11-,12+,13+,14+,15+,16+,17+,18+/m0/s1
InChI key:InChIKey=RXVWSYJTUUKTEA-CGQAXDJHSA-N
SMILES:O=CC(O)C(O)C(OC1OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O)C(O)CO
- Synonyms:
- <span class="text-smallcaps">D</smallcap>-Glucose, O-α-<smallcap>D</smallcap>-glucopyranosyl-(1→4)-O-α-<smallcap>D</span>-glucopyranosyl-(1→4)-
- <span class="text-smallcaps">D</span>-Maltotriose
- Amylotriose
- D-Glucose, O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-
- D-Maltotriose
- Maltotriose
- Maltriose
- Nsc 170180
- O-α-<span class="text-smallcaps">D</smallcap>-Glucopyranosyl-(1→4)-O-α-<smallcap>D</smallcap>-glucopyranosyl-(1→4)-<smallcap>D</span>-glucose
- O-α-D-glucopiranosil-(1→4)-O-α-D-glucopiranosil-(1→4)-O-α-D-glucopiranosa
- See more synonyms
- O-α-D-glucopyrannosyl-(1→4)-O-α-D-glucopyrannosyl-(1→4)-O-α-D-glucopyrannose
- Triomaltose