CAS 110919-71-6
:2-Pyridinamine, 5-fluoro-6-methyl-
Description:
2-Pyridinamine, 5-fluoro-6-methyl- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) at the 2-position and a fluorine atom at the 5-position, along with a methyl group (-CH3) at the 6-position of the pyridine ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The fluorine substituent can enhance the compound's biological activity and lipophilicity, while the amino group may participate in hydrogen bonding and other interactions. This compound is typically synthesized through specific chemical reactions involving pyridine derivatives and is subject to characterization techniques such as NMR and mass spectrometry to confirm its structure. As with many nitrogen-containing heterocycles, it may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, making it a subject of interest in medicinal chemistry research.
Formula:C6H7FN2
InChI:InChI=1/C6H7FN2/c1-4-5(7)2-3-6(8)9-4/h2-3H,1H3,(H2,8,9)
SMILES:Cc1c(ccc(=N)[nH]1)F
Synonyms:- 5-Fluor-6-methylpyridin-2-amin
- 5-Fluoro-6-methyl-2-pyridinamine
- 5-Fluoro-6-methylpyridin-2-amine
- 2-Amino-5-fluoro-6-methylpyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-5-fluoro-6-methylpyridine, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H7FN2Purity:98%Molecular weight:126.132-Amino-5-fluoro-6-methylpyridine
CAS:Formula:C6H7FN2Purity:97%Color and Shape:SolidMolecular weight:126.13162-Amino-5-fluoro-6-methylpyridine
CAS:2-Amino-5-fluoro-6-methylpyridineFormula:C6H7FN2Purity:96%Color and Shape: white to off-white solidMolecular weight:126.13g/mol2-Amino-5-fluoro-6-methylpyridine
CAS:Formula:C6H7FN2Purity:97%Color and Shape:Solid, Yellow powderMolecular weight:126.134



