CAS 110925-86-5
:3-deoxy-3-fluorofructose
Description:
3-Deoxy-3-fluorofructose is a synthetic analog of fructose, characterized by the substitution of a fluorine atom at the 3-position of the fructose molecule. This modification alters its biochemical properties, making it of interest in various fields, including biochemistry and medicinal chemistry. The presence of the fluorine atom can influence the compound's reactivity, stability, and interaction with biological systems, potentially affecting metabolic pathways. As a monosaccharide, it retains the basic structure of fructose, which is a six-carbon ketose sugar, but the fluorine substitution may impact its ability to participate in enzymatic reactions typically involving fructose. The compound is often studied for its potential applications in understanding sugar metabolism and as a tool in the development of therapeutic agents. Additionally, its unique properties may provide insights into the design of inhibitors or modulators of carbohydrate-active enzymes. Overall, 3-deoxy-3-fluorofructose represents a valuable compound for research in carbohydrate chemistry and its biological implications.
Formula:C6H11FO5
InChI:InChI=1/C6H11FO5/c7-5(3(10)1-8)6(12)4(11)2-9/h4-6,8-9,11-12H,1-2H2/t4-,5-,6-/m1/s1
SMILES:C(C(=O)[C@H]([C@@H]([C@@H](CO)O)O)F)O
Synonyms:- 3-Dff
- 3-Deoxy-3-fluoro-D-fructose
- D-Fructose, 3-deoxy-3-fluoro-
- (3S,4R,5R)-3-fluoro-1,4,5,6-tetrahydroxy-hexan-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Deoxy-3-fluoro-D-fructose
CAS:<p>3-Deoxy-3-fluoro-D-fructose is a monosaccharide that has been used as an inhibitor of glucose uptake and metabolism in the lymphocytic leukemia cell line. This compound has been shown to inhibit the glucose transporter GLUT1, which is responsible for the transport of glucose across the plasma membrane. 3-Deoxy-3-fluoro-D-fructose inhibits cancer cells by inhibiting galactitol production through inhibition of gluconeogenesis. It also inhibits oxidative phosphorylation in lymphocytic leukemia cells, leading to apoptosis. 3-Deoxy-3-fluoro-D-fructose has been shown to inhibit cancer growth by blocking glucose uptake in xenopus oocytes.</p>Purity:Min. 95%
