CAS 110927-03-2
:3,4-Dihydro-5-methoxy-2H-1-Benzopyran-3-amine
Description:
3,4-Dihydro-5-methoxy-2H-1-benzopyran-3-amine, with the CAS number 110927-03-2, is a chemical compound that belongs to the class of benzopyrans, which are characterized by a fused benzene and pyran ring structure. This compound features a methoxy group (-OCH3) and an amine group (-NH2) that contribute to its chemical reactivity and potential biological activity. The presence of the methoxy group can influence the compound's solubility and polarity, while the amine group may participate in hydrogen bonding and affect its interaction with biological targets. The dihydro form indicates that the compound has two hydrogen atoms added to the benzopyran structure, which may affect its stability and reactivity. Such compounds are often studied for their potential pharmacological properties, including antioxidant and anti-inflammatory activities. However, specific biological activities and applications would require further investigation through experimental studies. Overall, 3,4-Dihydro-5-methoxy-2H-1-benzopyran-3-amine represents a structurally interesting molecule with potential implications in medicinal chemistry.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-12-9-3-2-4-10-8(9)5-7(11)6-13-10/h2-4,7H,5-6,11H2,1H3
SMILES:COc1cccc2c1CC(CO2)N
Synonyms:- 5-Methoxychroman-3-Amine
- 5-methoxy-3,4-dihydro-2H-chromen-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
