CAS 110931-74-3

N-(naphthalen-1-ylmethyl)cyclopropanamine

Description:

N-(naphthalen-1-ylmethyl)cyclopropanamine, identified by its CAS number 110931-74-3, is an organic compound characterized by its unique structural features. It consists of a cyclopropane ring attached to an amine group, with a naphthylmethyl substituent, which contributes to its aromatic properties. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on its specific structure and functional groups. The presence of the naphthalene moiety suggests potential applications in organic synthesis and medicinal chemistry, as compounds with aromatic systems often display interesting biological activities. Additionally, the cyclopropane ring can impart strain, influencing the reactivity and stability of the molecule. As with many amines, it may exhibit basicity and can participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₄H₁₅N

InChI: InChI=1/C14H15N/c1-2-7-14-11(4-1)5-3-6-12(14)10-15-13-8-9-13/h1-7,13,15H,8-10H2

SMILES: c1ccc2c(c1)cccc2CNC1CC1

Synonyms:

• 1-naphthalenemethanamine, N-cyclopropyl-
• N-(1-Naphthylmethyl)cyclopropanamine