CAS 110932-40-6
:(5E)-5-(biphenyl-4-ylmethylidene)-2-sulfanyl-1,3-thiazol-4(5H)-one
Description:
(5E)-5-(Biphenyl-4-ylmethylidene)-2-sulfanyl-1,3-thiazol-4(5H)-one is a chemical compound characterized by its thiazole core, which features a sulfur atom and a carbonyl group, contributing to its reactivity and potential biological activity. The presence of a biphenyl group enhances its hydrophobic character, which may influence its solubility and interaction with biological membranes. This compound exhibits a specific geometric configuration denoted by the "(5E)" designation, indicating the trans configuration of the double bond in the thiazole ring. The sulfanyl group introduces nucleophilic properties, making it a candidate for various chemical reactions, including those involving electrophiles. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the thiazole moiety's known biological activities. Additionally, the compound's unique structure may allow for interactions with specific biological targets, warranting further investigation into its pharmacological properties and mechanisms of action.
Formula:C16H11NOS2
InChI:InChI=1/C16H11NOS2/c18-15-14(20-16(19)17-15)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-10H,(H,17,18,19)/b14-10+
Synonyms:- 4(5H)-thiazolone, 5-([1,1'-biphenyl]-4-ylmethylene)-2-mercapto-, (5E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.