CymitQuimica logo

CAS 110963-29-6

:

3-AMINO-1H-INDOLE-2-CARBOHYDRAZIDE

Description:
3-Amino-1H-indole-2-carbohydrazide is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features an amino group and a carbohydrazide functional group, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino and hydrazide groups. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a precursor for the synthesis of more complex molecules or as a potential pharmacophore in drug development. Its unique structure allows for interactions with biological targets, making it a candidate for further research in therapeutic applications. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H10N4O
InChI:InChI=1/C9H10N4O/c10-7-5-3-1-2-4-6(5)12-8(7)9(14)13-11/h1-4,12H,10-11H2,(H,13,14)
SMILES:c1ccc2c(c1)c(c(C(=NN)O)[nH]2)N
Synonyms:
  • 3-Aminoindol-2-Carbohydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.