CymitQuimica logo

CAS 110990-07-3

:

Fmoc-D-Lys(Z)-OH

Description:
Fmoc-D-Lys(Z)-OH, also known as Fmoc-D-lysine(Z)-hydroxylamine, is a protected form of the amino acid D-lysine, which is commonly used in peptide synthesis. The "Fmoc" (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amino functionality, allowing for selective reactions without interfering with the amine. The "Z" (benzyloxycarbonyl) group protects the side chain amino group of lysine, enhancing stability and solubility during synthesis. This compound is typically a white to off-white solid and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and methanol, but less soluble in water. Its structure allows for the introduction of D-lysine into peptides while maintaining the integrity of the amino acid's functional groups until deprotection is desired. Fmoc-D-Lys(Z)-OH is widely utilized in the field of medicinal chemistry and biochemistry for the synthesis of peptides with specific biological activities. Proper handling and storage are essential, as with many chemical substances, to maintain its stability and reactivity.
Formula:C29H30N2O6
InChI:InChI=1/C29H30N2O6/c32-27(33)26(16-8-9-17-30-28(34)36-18-20-10-2-1-3-11-20)31-29(35)37-19-25-23-14-6-4-12-21(23)22-13-5-7-15-24(22)25/h1-7,10-15,25-26H,8-9,16-19H2,(H,30,34)(H,31,35)(H,32,33)/t26-/m1/s1
InChI key:KRULQRVJXQQPQH-AREMUKBSSA-N
SMILES:c1ccc(cc1)COC(=NCCCC[C@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12)O
Synonyms:
  • N6-[(benzyloxy)carbonyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-lysine
Found 4 products.