CAS 110999-47-8

1,2,3,4,6,7,8-heptabromooxanthrene

Description:

1,2,3,4,6,7,8-heptabromooxanthrene is a polybrominated aromatic compound characterized by the presence of multiple bromine atoms attached to an oxanthrene core structure. This compound typically exhibits high thermal stability and is insoluble in water, making it more soluble in organic solvents. The bromination enhances its flame retardant properties, which is a significant characteristic for applications in materials science. Additionally, the presence of bromine atoms can influence the electronic properties of the molecule, potentially affecting its reactivity and interactions with other substances. Due to its complex structure, 1,2,3,4,6,7,8-heptabromooxanthrene may also exhibit unique photophysical properties, such as fluorescence or phosphorescence, depending on the specific arrangement of its substituents. However, the environmental and health impacts of such brominated compounds are a concern, as they can persist in the environment and may have toxicological effects. Therefore, handling and disposal of this compound require careful consideration of safety protocols.

Formula: C₁₂HBr₇O₂

InChI: InChI=1/C12HBr7O2/c13-2-1-3-10(7(17)4(2)14)21-12-9(19)6(16)5(15)8(18)11(12)20-3/h1H

SMILES: c1c(c(c(c2c1Oc1c(c(c(c(c1O2)Br)Br)Br)Br)Br)Br)Br

Synonyms:

• Dibenzo[B,E][1,4]Dioxin, 1,2,3,4,6,7,8-Heptabromo-
• 1,2,3,4,6,7,8-Heptabromooxanthrene