CAS 111-23-9
:N,N′′′-1,10-Decanediylbis[guanidine]
Description:
N,N′′′-1,10-Decanediylbis[guanidine], with the CAS number 111-23-9, is a chemical compound characterized by its guanidine functional groups linked by a decanediyl chain. This structure imparts unique properties, including its potential as a biocide and its application in various chemical syntheses. The compound is typically a white to off-white solid at room temperature and is soluble in polar solvents, which enhances its utility in biological and chemical applications. Its guanidine groups contribute to its basicity and ability to form hydrogen bonds, making it a versatile agent in catalysis and as a ligand in coordination chemistry. Additionally, due to its long hydrocarbon chain, it may exhibit surfactant properties, influencing its behavior in different environments. Safety data indicates that, like many guanidine derivatives, it should be handled with care, as it may pose health risks upon exposure. Overall, N,N′′′-1,10-Decanediylbis[guanidine] is a compound of interest in both industrial and research settings due to its diverse chemical behavior.
Formula:C12H28N6
InChI:InChI=1S/C12H28N6/c13-11(14)17-9-7-5-3-1-2-4-6-8-10-18-12(15)16/h1-10H2,(H4,13,14,17)(H4,15,16,18)
InChI key:InChIKey=OZZMUVKANAPKGI-UHFFFAOYSA-N
SMILES:C(NC(=N)N)CCCCCCCCCNC(=N)N
Synonyms:- 1,10-Diguanidinodecane
- 1,1′-Decamethylenediguanidine
- 2,2'-Decane-1,10-Diyldiguanidine
- 2,2'-Decane-1,10-Diyldiguanidine Dihydrochloride
- Bg 10
- Bis-G 10
- Guanidine, 1,1′-decamethylenedi-
- Guanidine, N,N′′′-1,10-decanediylbis-
- N,N′′′-1,10-Decanediylbis[guanidine]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
