CAS 111034-55-0
:(3'R,5'S)-3'-Hydroxycotinine Acetate
Description:
(3'R,5'S)-3'-Hydroxycotinine Acetate is a chemical compound derived from cotinine, which is a metabolite of nicotine. This substance is characterized by its specific stereochemistry, indicated by the (3'R,5'S) configuration, which refers to the spatial arrangement of its atoms and affects its biological activity. The presence of a hydroxyl group (-OH) at the 3' position and an acetate group (-OCOCH3) contributes to its solubility and reactivity. This compound is of interest in pharmacological research, particularly in studies related to nicotine metabolism and potential therapeutic applications. Its structural features may influence its interaction with biological targets, such as receptors or enzymes, making it relevant in the context of nicotine addiction and cessation therapies. Additionally, the acetate moiety can enhance its stability and bioavailability. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity, and its use should be guided by appropriate regulatory standards.
Formula:C12H14N2O3
InChI:InChI=1/C12H14N2O3/c1-8(15)17-11-6-10(14(2)12(11)16)9-4-3-5-13-7-9/h3-5,7,10-11H,6H2,1-2H3/t10-,11+/m0/s1
Synonyms:- (3R-trans)-3-(acetyloxy)-1-methyl-5-(3-pyridinyl)-2-pyrrolidinone
- Hydroxycotinine Acetate
- trans-3'-Hydroxycotinine Acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
trans-3'-Hydroxy Cotinine Acetate
CAS:Stability Hygroscopic
Applications Cotinine derivative. Carcinogen.Formula:C12H14N2O3Color and Shape:NeatMolecular weight:234.25trans-3'-Hydroxy Cotinine-d3 Acetate
CAS:Controlled ProductApplications trans-3'-Hydroxy Cotinine-d3 Acetate is an intermediate in the synthesis of trans-3'-Hydroxy Cotinine-d3 (Racemic Mixtures) (H924510), which is useful in organic synthesis.
References Desai, D., et al.: Chem. Res. Toxicol., 3, 47 (1990)Formula:C12D3H11N2O3Color and Shape:NeatMolecular weight:237.27

