CAS 111038-94-9

1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propan-1-one

Description:

1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propan-1-one, with the CAS number 111038-94-9, is a chemical compound characterized by its unique structural features, including a benzodioxepin moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the propan-1-one functional group suggests that it may participate in typical ketone reactions, such as nucleophilic addition. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the benzodioxepin framework, which is known for various biological activities. Additionally, the compound's solubility, stability, and potential for forming derivatives can be influenced by the substituents on the benzodioxepin ring and the propan-1-one chain. Overall, this compound represents a fascinating area of study within organic chemistry, with implications for both synthetic and applied research.

Formula: C₁₂H₁₄O₃

InChI: InChI=1/C12H14O3/c1-2-10(13)9-4-5-11-12(8-9)15-7-3-6-14-11/h4-5,8H,2-3,6-7H2,1H3

SMILES: CCC(=O)c1ccc2c(c1)OCCCO2

1-(3,4-Dihydro-2H-1,5-benzodioxepin-7-yl)propan-1-one

CAS: 111038-94-9

Formula: C₁₂H₁₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 206.2378

Ref: IN-DA01KCIM

1-(3,4-Dihydro-2H-benzo[b][1,4]dioxepin-7-yl)propan-1-one

CAS: 111038-94-9

1-(3,4-Dihydro-2H-benzo[b][1,4]dioxepin-7-yl)propan-1-one

Purity: 98%

Molecular weight: 206.24g/mol

Ref: 54-OR1061404