CymitQuimica logo

CAS 111042-98-9

:

Methyl 3-hydroxythieno[3,2-b]pyridine-2-carboxylate

Description:
Methyl 3-hydroxythieno[3,2-b]pyridine-2-carboxylate is a chemical compound characterized by its unique bicyclic structure, which combines a thieno and pyridine ring system. This compound features a hydroxyl group (-OH) and a carboxylate ester group (-COOCH3), contributing to its potential reactivity and solubility properties. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its interactions in various chemical environments. Methyl 3-hydroxythieno[3,2-b]pyridine-2-carboxylate is of interest in medicinal chemistry due to its structural motifs that may be relevant in drug design and development. Its CAS number, 111042-98-9, allows for easy identification in chemical databases and literature. The compound's properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods, and its applications may extend to areas such as pharmaceuticals, agrochemicals, or as a synthetic intermediate in organic chemistry.
Formula:C9H7NO3S
InChI:InChI=1S/C9H7NO3S/c1-13-9(12)8-7(11)6-5(14-8)3-2-4-10-6/h2-4,11H,1H3
InChI key:InChIKey=XHUQSLOQAMJFNH-UHFFFAOYSA-N
SMILES:OC=1C=2C(SC1C(OC)=O)=CC=CN2
Synonyms:
  • Methyl 3-hydroxythieno[3,2-b]pyridine-2-carboxylate
  • Thieno[3,2-b]pyridine-2-carboxylic acid, 3-hydroxy-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.