CAS 111043-48-2
:1-methylazetidin-3-ol
Description:
1-Methylazetidin-3-ol, with the CAS number 111043-48-2, is a cyclic amine characterized by its four-membered azetidine ring structure, which includes a hydroxyl group (-OH) and a methyl group (-CH3) attached to the nitrogen atom. This compound exhibits properties typical of secondary amines and alcohols, such as the ability to participate in hydrogen bonding due to the presence of the hydroxyl group, which can influence its solubility in polar solvents. The azetidine ring contributes to its rigidity and can affect its reactivity and interaction with other chemical species. Additionally, 1-methylazetidin-3-ol may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules, as well as in the study of its pharmacological properties. Overall, the unique combination of functional groups and ring structure makes 1-methylazetidin-3-ol a compound of interest in various chemical and pharmaceutical research contexts.
Formula:C4H9NO
InChI:InChI=1/C4H9NO/c1-5-2-4(6)3-5/h4,6H,2-3H2,1H3
SMILES:CN1CC(C1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Hydroxy-1-methylazetidine
CAS:Formula:C4H9NOPurity:96%Color and Shape:SolidMolecular weight:87.1204Ref: IN-DA003JJ3
1g138.00€5g329.00€10g559.00€25gTo inquire100gTo inquire250gTo inquire100mg67.00€250mg85.00€500mg129.00€1-Methylazetidin-3-ol
CAS:1-Methylazetidin-3-olFormula:C4H9NOPurity:96%Color and Shape: colourless to light yellow liquidMolecular weight:87.12g/mol3-Hydroxy-1-methylazetidine
CAS:3-Hydroxy-1-methylazetidine is a reagent that has a high quality and is useful as an intermediate, scaffold, or building block. It can be used in the synthesis of complex compounds. 3-Hydroxy-1-methylazetidine has been shown to be useful in reactions to produce fine chemicals and research chemicals. This chemical has versatile uses including being a reaction component for the synthesis of speciality chemicals.Formula:C4H9NOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:87.12 g/mol



