CymitQuimica logo

CAS 111043-49-3

:

1-[(4-Fluorophenyl)methyl]-3-azetidinol

Description:
1-[(4-Fluorophenyl)methyl]-3-azetidinol, identified by its CAS number 111043-49-3, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a fluorophenyl group indicates that there is a fluorine atom attached to a phenyl ring, which can influence the compound's electronic properties and reactivity. This compound may exhibit specific pharmacological activities due to its structural features, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular conformation. Additionally, the azetidine ring can participate in various chemical reactions, including nucleophilic substitutions and ring-opening reactions, which are relevant in synthetic organic chemistry. Overall, the unique combination of the azetidine framework and the fluorophenyl substituent contributes to the compound's potential applications in drug development and other chemical research areas.
Formula:C10H12FNO
InChI:InChI=1S/C10H12FNO/c11-9-3-1-8(2-4-9)5-12-6-10(13)7-12/h1-4,10,13H,5-7H2
InChI key:InChIKey=JKNYOFXNAYHDJV-UHFFFAOYSA-N
SMILES:C(N1CC(O)C1)C2=CC=C(F)C=C2
Found 4 products.