CAS 111043-50-6

1-[(4-Chlorophenyl)methyl]-3-azetidinol

Description:

1-[(4-Chlorophenyl)methyl]-3-azetidinol, with the CAS number 111043-50-6, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a 4-chlorobenzyl group contributes to its unique properties, including potential biological activity. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding due to the hydroxyl group, influencing its solubility and reactivity. Additionally, the chlorine substituent on the phenyl ring can affect the compound's lipophilicity and overall biological interactions. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings. Further research may be necessary to fully elucidate its properties and potential uses in various fields.

Formula: C₁₀H₁₂ClNO

InChI: InChI=1S/C10H12ClNO/c11-9-3-1-8(2-4-9)5-12-6-10(13)7-12/h1-4,10,13H,5-7H2

InChI key: InChIKey=XJIZBIGPVVLRRZ-UHFFFAOYSA-N

SMILES: C(N1CC(O)C1)C2=CC=C(Cl)C=C2

Synonyms:

• 1-[(4-Chlorophenyl)methyl]-3-azetidinol
• 3-Azetidinol, 1-[(4-chlorophenyl)methyl]-
• N-(p-Chlorobenzyl)azetidin-3-ol
• 1-(4-Chlorobenzyl)-azetidine-3-ol