CymitQuimica logo

CAS 111047-55-3

:

4-Methyl-N-(1-phenylpropylidene)benzenesulfonamide

Description:
4-Methyl-N-(1-phenylpropylidene)benzenesulfonamide, identified by its CAS number 111047-55-3, is an organic compound characterized by its sulfonamide functional group, which is known for its biological activity and potential pharmaceutical applications. This compound features a sulfonamide moiety attached to a benzene ring, with a methyl group and a phenylpropylidene substituent, contributing to its structural complexity. The presence of the sulfonamide group often imparts properties such as solubility in polar solvents and the ability to form hydrogen bonds, which can influence its reactivity and interaction with biological targets. The compound may exhibit various physical properties, including melting and boiling points, which are influenced by its molecular structure and intermolecular forces. Additionally, due to its unique configuration, it may possess specific pharmacological activities, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its properties, potential applications, and safety profile.
Formula:C16H17NO2S
InChI:InChI=1S/C16H17NO2S/c1-3-16(14-7-5-4-6-8-14)17-20(18,19)15-11-9-13(2)10-12-15/h4-12H,3H2,1-2H3
InChI key:InChIKey=MDDUJBHJSOBZBB-UHFFFAOYSA-N
SMILES:C(=NS(=O)(=O)C1=CC=C(C)C=C1)(CC)C2=CC=CC=C2
Synonyms:
  • Benzenesulfonamide, 4-methyl-N-(1-phenylpropylidene)-
  • 4-Methyl-N-(1-phenylpropylidene)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.