CAS 111050-72-7
:1-(3,5-Dichloro-2,6-dihydroxy-4-methoxyphenyl)-1-hexanone
Description:
1-(3,5-Dichloro-2,6-dihydroxy-4-methoxyphenyl)-1-hexanone, with the CAS number 111050-72-7, is an organic compound characterized by its complex structure, which includes a hexanone moiety and a substituted phenolic ring. The presence of dichloro and methoxy groups on the aromatic ring contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The hydroxyl groups indicate that the compound may exhibit hydrogen bonding capabilities, influencing its solubility in polar solvents. This compound may also possess biological activity due to its structural features, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the presence of chlorine atoms may enhance its lipophilicity, affecting its distribution in biological systems. Overall, this compound's characteristics make it a subject of interest for further studies in medicinal chemistry and related fields.
Formula:C13H16Cl2O4
InChI:InChI=1S/C13H16Cl2O4/c1-3-4-5-6-7(16)8-11(17)9(14)13(19-2)10(15)12(8)18/h17-18H,3-6H2,1-2H3
InChI key:InChIKey=VUDQSRFCCHQIIU-UHFFFAOYSA-N
SMILES:C(CCCCC)(=O)C1=C(O)C(Cl)=C(OC)C(Cl)=C1O
Synonyms:- 1-(3,5-Dichloro-2,6-Dihydroxy-4-Methoxyphenyl)Hexan-1-One
- 1-Hexanone, 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)-
- Dif 1
- Dif-1 (dictyostelium)
- Differentiation-inducing factor 1
- Morphogen differentiation inducing factor (dictyostelium)
- 1-(3,5-Dichloro-2,6-dihydroxy-4-methoxyphenyl)-1-hexanone
- 1-((3,5-Dichloro)-2,6-dihydroxy-4-methoxyphenyl)-1-hexanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
