
CAS 111055-92-6
:6-Chloropurine
Description:
6-Chloropurine is a purine derivative characterized by the presence of a chlorine atom at the 6-position of the purine ring. It is a white to off-white crystalline solid that is soluble in polar solvents such as water and dimethyl sulfoxide (DMSO). This compound is of interest in medicinal chemistry, particularly for its potential use as an antiviral and anticancer agent, as it can interfere with nucleic acid synthesis. The molecular formula of 6-chloropurine is C5H4ClN5, and it has a molecular weight that reflects its composition of carbon, hydrogen, chlorine, and nitrogen atoms. Its structure allows it to mimic natural purines, which can lead to its incorporation into nucleic acids, thereby disrupting normal cellular processes. As with many chemical substances, handling 6-chloropurine requires appropriate safety precautions due to its potential biological activity and reactivity.
Formula:C5H3ClN4
InChI:InChI=1S/C5H3ClN4/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H,7,8,9,10)
InChI key:InChIKey=ZKBQDFAWXLTYKS-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC=N1)N=CN2
Synonyms:- Purine, 6-chloro-
- 1H-Purine, 6-chloro-
- 9H-Purine, 6-chloro-
- 6-Chloropurine
- 6-Chloro-9H-purine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.