CymitQuimica logo

CAS 111061-54-2

:

Fmoc-Lys(Trt)-OH

Description:
Fmoc-Lys(Trt)-OH, also known as Fmoc-Lysine(Trityl)-OH, is a protected amino acid commonly used in peptide synthesis. The "Fmoc" (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amino group, allowing for selective reactions during peptide assembly. The "Lys" refers to lysine, an essential amino acid characterized by its positively charged side chain at physiological pH, which plays a crucial role in protein structure and function. The "Trt" (trityl) group protects the side chain amino group of lysine, providing stability and preventing unwanted reactions during synthesis. This compound is typically used in solid-phase peptide synthesis, where the Fmoc group can be easily removed under basic conditions, facilitating the sequential addition of amino acids. Fmoc-Lys(Trt)-OH is valued for its ability to enhance solubility and reactivity in organic solvents, making it a versatile building block in the development of peptides and proteins for research and therapeutic applications. Its CAS number, 111061-54-2, is a unique identifier that aids in the cataloging and procurement of this specific chemical substance.
Formula:C40H38N2O4
InChI:InChI=1S/C40H38N2O4/c43-38(44)37(42-39(45)46-28-36-34-24-12-10-22-32(34)33-23-11-13-25-35(33)36)26-14-15-27-41-40(29-16-4-1-5-17-29,30-18-6-2-7-19-30)31-20-8-3-9-21-31/h1-13,16-25,36-37,41H,14-15,26-28H2,(H,42,45)(H,43,44)/t37-/m0/s1
InChI key:CEOOTQDKDICVJW-QNGWXLTQSA-N
SMILES:C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NCCCC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46
Synonyms:
  • GenBank CR050980
  • Fmoc-Lysine(Trt)
Found 4 products.