CAS 111061-56-4
:N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-O-(triphenylmethyl)-L-serine
Description:
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-O-(triphenylmethyl)-L-serine, commonly referred to as Fmoc-Ser(Trt)-OH, is a protected amino acid derivative used primarily in peptide synthesis. This compound features a fluorenylmethoxycarbonyl (Fmoc) group, which serves as a protective group for the amino functionality, allowing for selective reactions during peptide assembly. The triphenylmethyl (Trt) group protects the hydroxyl group of the serine residue, enhancing the stability and reactivity of the molecule. Fmoc-Ser(Trt)-OH is typically utilized in solid-phase peptide synthesis due to its compatibility with various coupling reagents and its ability to undergo deprotection under mild conditions. The compound is characterized by its relatively high molecular weight and specific stereochemistry, as it contains the L-form of serine. Its solubility in organic solvents and stability under standard laboratory conditions make it a valuable intermediate in the synthesis of peptides and other bioactive compounds. Overall, this substance plays a crucial role in the field of medicinal chemistry and peptide research.
Formula:C37H31NO5
InChI:InChI=1S/C37H31NO5/c39-35(40)34(38-36(41)42-24-33-31-22-12-10-20-29(31)30-21-11-13-23-32(30)33)25-43-37(26-14-4-1-5-15-26,27-16-6-2-7-17-27)28-18-8-3-9-19-28/h1-23,33-34H,24-25H2,(H,38,41)(H,39,40)/t34-/m0/s1
InChI key:InChIKey=UCARTONYOJORBQ-UMSFTDKQSA-N
SMILES:C(OC[C@H](NC(OCC1C=2C(C=3C1=CC=CC3)=CC=CC2)=O)C(O)=O)(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6
Synonyms:- <span class="text-smallcaps">L</span>-Serine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-(triphenylmethyl)-
- Fmoc-Ser(Trt)-OH
- N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-O-(triphenylmethyl)-<span class="text-smallcaps">L</span>-serine
- N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-trityl-D-serine
- N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-trityl-L-serine
- N-alpha-(9-fluorenylmethyloxycarbonyl)-O-trityl-L-serine
- N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-O-(triphenylmethyl)-L-serine
- L-Serine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-(triphenylmethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Fmoc-Ser(Trt)-OH
CAS:The trityl group can be removed by 1% TFA, leaving other protecting groups intact.Formula:C37H31NO5Purity:99.2%Color and Shape:White PowderMolecular weight:569.66Fmoc-Ser(Trt)-OH
CAS:Formula:C37H31NO5Purity:≥ 98.0%Color and Shape:White to almost white powderMolecular weight:569.65Fmoc-Ser(Trt)-OH
CAS:M03386 - Fmoc-Ser(Trt)-OH
Formula:C37H31NO5Purity:95%Color and Shape:SolidMolecular weight:569.657Fmoc-O-trityl-L-serine
CAS:Fmoc-O-trityl-L-serine is a synthetic molecule that is not naturally occurring. It has been shown to have inhibitory effects on the growth of cancer cells in vitro and in vivo, but does not affect healthy cells. Fmoc-O-trityl-L-serine binds to the membrane of cancer cells and inhibits protein synthesis by binding to ribosomes. This drug also inhibits cell growth by interfering with the membrane interactions necessary for cellular metabolism. Fmoc-O-trityl-L-serine is toxic to red blood cells, which may be due to its ability to induce hemolysis.
Formula:C37H31NO5Purity:Min. 95%Molecular weight:569.65 g/mol





