CAS 1110767-94-6

1-Bromo-3-[(1S)-1-(hexyloxy)ethyl]-2-methoxybenzene

Description:

1-Bromo-3-[(1S)-1-(hexyloxy)ethyl]-2-methoxybenzene, with the CAS number 1110767-94-6, is an organic compound characterized by its complex structure, which includes a bromine atom, a methoxy group, and a hexyl ether moiety. This compound features a benzene ring substituted at specific positions, contributing to its unique chemical properties. The presence of the bromine atom indicates potential reactivity, particularly in nucleophilic substitution reactions. The hexoxy group enhances its solubility in organic solvents and may influence its biological activity. The stereochemistry of the (1S)-1-(hexyloxy)ethyl group suggests that the compound may exhibit chirality, which can affect its interaction with biological systems. Additionally, the methoxy group can participate in hydrogen bonding and may influence the compound's polarity and reactivity. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science, where its unique functional groups can be leveraged for specific applications.

Formula: C₁₅H₂₃BrO₂

InChI: InChI=1S/C15H23BrO2/c1-4-5-6-7-11-18-12(2)13-9-8-10-14(16)15(13)17-3/h8-10,12H,4-7,11H2,1-3H3/t12-/m0/s1

InChI key: InChIKey=OLVDKTNFGWLPMV-LBPRGKRZSA-N

SMILES: [C@H](OCCCCCC)(C)C1=C(OC)C(Br)=CC=C1

Synonyms:

• 1-Bromo-3-[(1S)-1-(hexyloxy)ethyl]-2-methoxybenzene
• (S)-1-Bromo-3-(1-(hexyloxy)ethyl)-2-methoxybenzene
• Benzene, 1-bromo-3-[(1S)-1-(hexyloxy)ethyl]-2-methoxy-