CAS 1110772-04-7
:(1S,3R)-3-AMINOCYCLOHEXANOL
Description:
(1S,3R)-3-Aminocyclohexanol is a chiral amine and alcohol that features a cyclohexane ring with an amino group and a hydroxyl group attached to it. The specific stereochemistry indicated by the (1S,3R) designation refers to the spatial arrangement of the atoms around the chiral centers, which can influence the compound's biological activity and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in water and organic solvents, making it versatile for various applications in organic synthesis and pharmaceuticals. The presence of both an amino and a hydroxyl group allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, (1S,3R)-3-aminocyclohexanol can serve as a building block for the synthesis of more complex molecules, including potential drug candidates. Its unique structure and properties make it a subject of study in fields such as asymmetric synthesis and drug development.
Formula:C6H13NO
InChI:InChI=1S/C6H13NO/c7-5-2-1-3-6(8)4-5/h5-6,8H,1-4,7H2/t5-,6+/m1/s1
InChI key:InChIKey=NIQIPYGXPZUDDP-RITPCOANSA-N
SMILES:N[C@H]1C[C@@H](O)CCC1
Synonyms:- Cyclohexanol, 3-amino-, (1S,3R)-
- Cis-(1S,3R)-3-aMinocyclohexanol hydrochloride
- (1S,3R)-3-AMINOCYCLOHEXANOL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(1S,3R)-3-Aminocyclohexanol Hydrochloride
CAS:Controlled ProductApplications (1S,3R)-3-Aminocyclohexanol Hydrochloride is used as a reactant in the preparation of isoxazole carboxamide compounds as potent, soluble, orally active TRPV1 antagonists and analgesics.
References Palin, R., et al.: Bioorg. Med. Chem. Lett., 21, 892 (2011); Ratcliffe, P., et al.: Bioorg. Med. Chem. Lett., 21, 2559 (2011);Formula:C6H13NO·HClColor and Shape:NeatMolecular weight:151.63

