
CAS 1110772-09-2
:(1R,3S)-3-(Aminomethyl)cyclopentanol
Description:
(1R,3S)-3-(Aminomethyl)cyclopentanol is a chiral organic compound characterized by its cyclopentane ring structure, which features an amino group and a hydroxyl group. The presence of the amino group (-NH2) contributes to its potential as a building block in pharmaceutical synthesis, particularly in the development of biologically active molecules. The specific stereochemistry indicated by the (1R,3S) configuration suggests that the compound exhibits optical activity, which can influence its interaction with biological systems and receptors. This compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the hydroxyl and amino functionalities. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and the presence of other functional groups. As a result, (1R,3S)-3-(Aminomethyl)cyclopentanol is of interest in medicinal chemistry and materials science, where its unique structural features can be exploited for various applications.
Formula:C6H13NO
InChI:InChI=1S/C6H13NO/c7-4-5-1-2-6(8)3-5/h5-6,8H,1-4,7H2/t5-,6+/m0/s1
InChI key:InChIKey=NUBNZASXRSXFRW-NTSWFWBYSA-N
SMILES:C(N)[C@@H]1C[C@H](O)CC1
Synonyms:- [((1S,3R)-3-Hydroxycyclopentyl)methyl]amine
- Cyclopentanol, 3-(aminomethyl)-, (1R,3S)-
- (1R,3S)-3-(Aminomethyl)cyclopentanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.