CAS 111079-43-7

2-(Trimethylsilyl)furo[2,3-b]pyridine

Description:

2-(Trimethylsilyl)furo[2,3-b]pyridine, with the CAS number 111079-43-7, is an organic compound characterized by its unique fused ring structure that combines a furan and pyridine moiety. This compound features a trimethylsilyl group, which enhances its stability and solubility in organic solvents. The presence of the furo and pyridine rings contributes to its potential reactivity, making it a candidate for various chemical transformations, including nucleophilic substitutions and electrophilic aromatic reactions. It is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The trimethylsilyl group also serves as a protecting group for functional groups during synthesis. In terms of physical properties, it is generally a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its chemical behavior can be influenced by the electronic effects of the silyl group, making it a valuable compound in the field of medicinal chemistry and materials science.

Formula: C₁₀H₁₃NOSi

InChI: InChI=1S/C10H13NOSi/c1-13(2,3)9-7-8-5-4-6-11-10(8)12-9/h4-7H,1-3H3

InChI key: InChIKey=FECPNIXWWDTUGF-UHFFFAOYSA-N

SMILES: [Si](C)(C)(C)C1=CC=2C(O1)=NC=CC2

Synonyms:

• 2-(Trimethylsilyl)furo[2,3-b]pyridine
• Furo[2,3-b]pyridine, 2-(trimethylsilyl)-