CAS 1110813-35-8

2,2′-[Carbonylbis(thio)]bis[ethanesulfonic acid]

Description:

2,2′-[Carbonylbis(thio)]bis[ethanesulfonic acid], with the CAS number 1110813-35-8, is a chemical compound characterized by its unique structure that includes two ethanesulfonic acid groups linked by a carbonyl and thioether moieties. This compound is typically a white to off-white solid and is soluble in water, which is a common trait for sulfonic acids due to their ionic nature. The presence of sulfonic acid groups imparts strong acidity, making it a potential candidate for various applications in biochemical and industrial processes. Its thioether linkage may contribute to its stability and reactivity, allowing it to participate in nucleophilic substitution reactions. Additionally, the compound may exhibit properties such as chelation with metal ions, which can be useful in catalysis or as a reagent in organic synthesis. Overall, 2,2′-[Carbonylbis(thio)]bis[ethanesulfonic acid] is a versatile compound with potential applications in research and industry, particularly in areas requiring strong acids or specific reactivity profiles.

Formula: C₅H₁₀O₇S₄

InChI: InChI=1S/C5H10O7S4/c6-5(13-1-3-15(7,8)9)14-2-4-16(10,11)12/h1-4H2,(H,7,8,9)(H,10,11,12)

InChI key: InChIKey=ZONAJVVPLXVSBW-UHFFFAOYSA-N

SMILES: C(S(=O)(=O)O)CSC(SCCS(=O)(=O)O)=O

Synonyms:

• Ethanesulfonic acid, 2,2′-[carbonylbis(thio)]bis-
• 2,2′-[Carbonylbis(thio)]bis[ethanesulfonic acid]

2,2'-[Carbonylbis(thio)]bisethanesulfonic Acid Dipotassium Salt

Controlled Product

CAS: 1110574-95-2, 1110813-35-8

Applications 2,2'-[Carbonylbis(thio)]bisethanesulfonic Acid Dipotassium Salt is an impurity of Mesna (M225750).

Formula: C₅H₈K₂O₇S₄

Color and Shape: Neat

Molecular weight: 386.57

Ref: TR-C177010