CAS 111098-20-5
:N-2-Pyridinyl-1H-benzotriazole-1-methanamine
Description:
N-2-Pyridinyl-1H-benzotriazole-1-methanamine, with the CAS number 111098-20-5, is a chemical compound characterized by its unique structure that combines a pyridine ring with a benzotriazole moiety. This compound typically exhibits properties associated with both aromatic systems, such as stability and potential for π-π interactions. It is often utilized in various applications, including as a corrosion inhibitor, due to its ability to form stable complexes with metal ions. The presence of the amine functional group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis usually involves multi-step organic reactions, and it is important to handle it with care due to potential toxicity or reactivity. Overall, N-2-Pyridinyl-1H-benzotriazole-1-methanamine is a versatile compound with significant implications in both industrial and research settings.
Formula:C12H11N5
InChI:InChI=1S/C12H11N5/c1-2-6-11-10(5-1)15-16-17(11)9-14-12-7-3-4-8-13-12/h1-8H,9H2,(H,13,14)
InChI key:InChIKey=IDHWGESQZWEGEL-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=N1)N2C=3C(N=N2)=CC=CC3
Synonyms:- N-2-Pyridinyl-1H-benzotriazole-1-methanamine
- 1H-Benzotriazole-1-methanamine, N-2-pyridinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
