
CAS 111098-38-5
:N-(2,2-Dimethylpropyl)-2-pyridinamine
Description:
N-(2,2-Dimethylpropyl)-2-pyridinamine, with the CAS number 111098-38-5, is an organic compound characterized by its pyridine ring and an amine functional group. This substance features a branched alkyl chain, specifically a 2,2-dimethylpropyl group, which contributes to its steric properties and potentially influences its reactivity and solubility. The presence of the pyridine ring imparts basicity to the compound, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the amine group can engage in hydrogen bonding, affecting its physical properties such as boiling point and solubility in polar solvents. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and behavior in different environments would depend on further studies, including its interaction with other chemical species and its stability under various conditions. Overall, N-(2,2-Dimethylpropyl)-2-pyridinamine is a versatile compound with potential utility in various chemical and pharmaceutical contexts.
Formula:C10H16N2
InChI:InChI=1S/C10H16N2/c1-10(2,3)8-12-9-6-4-5-7-11-9/h4-7H,8H2,1-3H3,(H,11,12)
InChI key:InChIKey=LDKRDTGJDTXAGK-UHFFFAOYSA-N
SMILES:N(CC(C)(C)C)C1=CC=CC=N1
Synonyms:- 2-Pyridinamine, N-(2,2-dimethylpropyl)-
- N-(2,2-Dimethylpropyl)-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.