
CAS 111104-26-8
:2H-Isoindole-2-acetic acid, 5,6-dichloro-1,3-dihydro-α-methyl-1,3-dioxo-, (S)-
Description:
2H-Isoindole-2-acetic acid, 5,6-dichloro-1,3-dihydro-α-methyl-1,3-dioxo-, (S)-, with CAS number 111104-26-8, is a chemical compound characterized by its isoindole structure, which features a bicyclic framework. This compound contains multiple functional groups, including an acetic acid moiety and a dioxo group, contributing to its potential reactivity and biological activity. The presence of dichloro substituents indicates that it may exhibit unique electronic properties and influence its interaction with biological targets. The (S)- designation suggests that it is a chiral molecule, with specific stereochemistry that can affect its pharmacological profile. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances, making it important to consider these factors in practical applications. Overall, this compound represents a class of molecules with potential therapeutic implications, warranting further investigation into its properties and effects.
Formula:C11H7Cl2NO4
InChI:InChI=1S/C11H7Cl2NO4/c1-4(11(17)18)14-9(15)5-2-7(12)8(13)3-6(5)10(14)16/h2-4H,1H3,(H,17,18)/t4-/m0/s1
InChI key:InChIKey=IEODYFJEEGJUQB-BYPYZUCNSA-N
SMILES:O=C1C=2C(C(=O)N1[C@H](C(O)=O)C)=CC(Cl)=C(Cl)C2
Synonyms:- (2S)-2-(5,6-Dichloro-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)propanoic acid
- 2H-Isoindole-2-acetic acid, 5,6-dichloro-1,3-dihydro-α-methyl-1,3-dioxo-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.