CAS 111108-40-8
:2-amino-4,5-dimethylpyridine-3-carboxylic acid
Description:
2-Amino-4,5-dimethylpyridine-3-carboxylic acid, with the CAS number 111108-40-8, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its acidic properties. The presence of two methyl groups at the 4 and 5 positions of the pyridine ring enhances its hydrophobic character while influencing its reactivity and solubility in various solvents. The amino group can participate in hydrogen bonding, making the compound potentially useful in various biological and chemical applications. Additionally, the carboxylic acid group can undergo typical acid-base reactions, allowing for the formation of salts and esters. This compound may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals, and its structural features suggest potential applications in medicinal chemistry, particularly in the development of compounds with biological activity.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c1-4-3-10-7(9)6(5(4)2)8(11)12/h3H,1-2H3,(H2,9,10)(H,11,12)
SMILES:Cc1c[nH]c(=N)c(c1C)C(=O)O
Synonyms:- 2-Amino-4,5-dimethylnicotinic acid
- 3-Pyridinecarboxylic Acid, 2-Amino-4,5-Dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
