CAS 1111085-36-9

3,4,5-Trichloro-1H-pyrrole-2-carboxylic acid

Description:

3,4,5-Trichloro-1H-pyrrole-2-carboxylic acid is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of three chlorine atoms at the 3, 4, and 5 positions of the pyrrole ring significantly influences its chemical reactivity and physical properties, making it a highly chlorinated derivative. The carboxylic acid functional group at the 2-position contributes to its acidity and potential for forming salts and esters. This compound is typically used in research and development, particularly in the fields of agrochemicals and pharmaceuticals, due to its potential biological activity. Its chlorinated nature may impart unique properties, such as increased lipophilicity or altered solubility in various solvents. Safety considerations are essential when handling this compound, as chlorinated compounds can pose environmental and health risks. Overall, 3,4,5-Trichloro-1H-pyrrole-2-carboxylic acid is a notable compound in synthetic organic chemistry with applications that warrant further exploration.

Formula: C₅H₂Cl₃NO₂

InChI: InChI=1S/C5H2Cl3NO2/c6-1-2(7)4(8)9-3(1)5(10)11/h9H,(H,10,11)

InChI key: InChIKey=LMXSZWFRGRIPQR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Cl)C(Cl)=C(Cl)N1

Synonyms:

• 3,4,5-Trichloro-pyrrole-2-carboxylic acid
• 3,4,5-Trichloro-1H-pyrrole-2-carboxylic acid
• 1H-Pyrrole-2-carboxylic acid, 3,4,5-trichloro-