CymitQuimica logo

CAS 1111088-89-1

:

Hydroxy Sprengerinin C, 14-

Description:
Hydroxy Sprengerinin C, with the CAS number 1111088-89-1, is a chemical compound that belongs to a class of substances known for their potential biological activities. While specific characteristics such as molecular weight, structure, and solubility may vary, compounds in this category often exhibit properties that make them of interest in medicinal chemistry and pharmacology. Hydroxy Sprengerinin C may possess functional groups that contribute to its reactivity and interaction with biological targets. Additionally, it may demonstrate antioxidant, anti-inflammatory, or antimicrobial properties, which are common among similar compounds. The presence of hydroxyl groups typically enhances solubility in polar solvents and can influence the compound's overall stability and reactivity. As with many specialized compounds, detailed studies and analyses are necessary to fully understand its characteristics, including its synthesis, mechanism of action, and potential applications in various fields such as drug development or natural product chemistry.
Formula:C44H70O17
InChI:InChI=1S/C44H70O17/c1-19-8-13-44(55-17-19)20(2)29-27(61-44)15-43(53)25-7-6-22-14-23(9-11-41(22,4)24(25)10-12-42(29,43)5)57-40-37(60-39-34(51)32(49)30(47)21(3)56-39)35(52)36(28(16-45)58-40)59-38-33(50)31(48)26(46)18-54-38/h6,19-21,23-40,45-53H,7-18H2,1-5H3/t19-,20+,21+,23+,24+,25-,26-,27+,28-,29+,30+,31+,32-,33-,34-,35+,36-,37-,38+,39+,40-,41+,42-,43-,44-/m1/s1
InChI key:AONBXCCYURJCAY-LSXBRKLISA-N
SMILES:C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@]4([C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)O)C)OC1
Found 6 products.