CAS 1111096-06-0: 4,4,5,5-Tetramethyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane
Description:4,4,5,5-Tetramethyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its complex structure, which includes a dioxaborolane ring and multiple fluorinated aromatic substituents. The presence of the dioxaborolane moiety suggests potential applications in organic synthesis, particularly in the formation of boron-containing intermediates. The compound's tetrafluorinated phenyl group enhances its chemical stability and lipophilicity, making it suitable for various applications in materials science and medicinal chemistry. Its high fluorine content may impart unique electronic properties, influencing reactivity and interaction with biological systems. Additionally, the bulky tetramethyl groups contribute to steric hindrance, which can affect the compound's reactivity and solubility. Overall, this compound exemplifies the intersection of organoboron chemistry and fluorinated compounds, offering potential utility in advanced chemical applications, including drug development and polymer science. However, specific handling and safety precautions should be observed due to the presence of fluorinated groups, which can exhibit unique environmental and health considerations.
Formula:C13H12BF7O2
InChI:InChI=1S/C13H12BF7O2/c1-11(2)12(3,4)23-14(22-11)6-9(17)7(15)5(13(19,20)21)8(16)10(6)18/h1-4H3
InChI key:InChIKey=JPXZPDCINADJKN-UHFFFAOYSA-N
SMILES:FC=1C(F)=C(C(F)=C(F)C1B2OC(C)(C)C(O2)(C)C)C(F)(F)F
- Synonyms:
- 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-
- 4,4,5,5-Tetramethyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane

4,4,5,5-Tetramethyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane
Ref: IN-DA008SIV
Undefined size | To inquire |

4,4,5,5-Tetramethyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane
Ref: 54-PC48629
1g | 382.00 € | ||
250mg | 143.00 € |

4,4,5,5-Tetramethyl-2-(2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl)-1,3,2-dioxaborolane
Ref: 10-F696912
1g | Discontinued | Request information | |
250mg | Discontinued | Request information |

2,3,5,6-Tetrafluoro-4-(trifluoromethyl)phenylboronic acid pinacol ester
Ref: 3D-FT104195
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |