
CAS 1111096-10-6
:2-(4-Bromo-2,3,5,6-tetrafluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-(4-Bromo-2,3,5,6-tetrafluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structure, which includes a dioxaborolane ring and a highly substituted aromatic system. The presence of the bromine and multiple fluorine atoms on the phenyl group contributes to its potential reactivity and solubility properties, making it of interest in various chemical applications, including organic synthesis and materials science. The dioxaborolane moiety is known for its ability to participate in cross-coupling reactions, particularly in the formation of carbon-boron bonds, which are valuable in the synthesis of complex organic molecules. Additionally, the steric hindrance provided by the tetramethyl substituents enhances its stability and may influence its reactivity profile. This compound may also exhibit interesting electronic properties due to the electron-withdrawing effects of the fluorine atoms, which can affect its behavior in chemical reactions and interactions with other substances. Overall, its unique structural features make it a compound of interest in both academic and industrial research settings.
Formula:C12H12BBrF4O2
InChI:InChI=1S/C12H12BBrF4O2/c1-11(2)12(3,4)20-13(19-11)5-7(15)9(17)6(14)10(18)8(5)16/h1-4H3
InChI key:InChIKey=FWPCPWPEIQINBH-UHFFFAOYSA-N
SMILES:FC1=C(C(F)=C(F)C(Br)=C1F)B2OC(C)(C)C(C)(C)O2
Synonyms:- 2-(4-Bromo-2,3,5,6-tetrafluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-(4-bromo-2,3,5,6-tetrafluorophenyl)-4,4,5,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.