CymitQuimica logo

CAS 1111096-19-5

:

2-(2,6-Difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-(2,6-Difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a substituted aromatic system. The presence of the difluoro and methoxy groups on the phenyl ring contributes to its electronic properties, potentially enhancing its reactivity and solubility in various solvents. The dioxaborolane moiety is known for its stability and ability to participate in various chemical reactions, including cross-coupling reactions, making it valuable in synthetic organic chemistry. This compound may exhibit interesting biological activities due to its specific functional groups, which can influence interactions with biological targets. Additionally, its physical properties, such as melting point, boiling point, and solubility, would depend on the overall molecular structure and the presence of substituents. Overall, this compound represents a versatile building block in the development of pharmaceuticals and agrochemicals, with potential applications in materials science as well.
Formula:C13H17BF2O3
InChI:InChI=1S/C13H17BF2O3/c1-12(2)13(3,4)19-14(18-12)11-9(15)6-8(17-5)7-10(11)16/h6-7H,1-5H3
InChI key:InChIKey=BXICLURBOWTZED-UHFFFAOYSA-N
SMILES:FC1=C(B2OC(C)(C)C(C)(C)O2)C(F)=CC(OC)=C1
Synonyms:
  • 2-(2,6-Difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 2-(2,6-difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-
  • 2,6-Difluoro-4-methoxyphenylboronic acid pinacol ester
Found 4 products.