CymitQuimica logo

CAS 1111102-81-8

:

5-[3-(Hydroxymethyl)phenyl]-2(1H)-pyridinone

Description:
5-[3-(Hydroxymethyl)phenyl]-2(1H)-pyridinone, identified by its CAS number 1111102-81-8, is an organic compound characterized by its pyridinone core structure, which features a hydroxymethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the hydroxymethyl group. The hydroxymethyl group can participate in hydrogen bonding, influencing the compound's reactivity and interactions with other molecules. Additionally, the pyridinone moiety may exhibit tautomerism, allowing for different structural forms that can affect its chemical behavior. This compound may also possess biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and reactivity would depend on the functional groups present and the overall molecular structure, which can influence its role in various chemical reactions or biological systems.
Formula:C12H11NO2
InChI:InChI=1S/C12H11NO2/c14-8-9-2-1-3-10(6-9)11-4-5-12(15)13-7-11/h1-7,14H,8H2,(H,13,15)
InChI key:InChIKey=PYNQEGVQMFFSQA-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(C=CC1)C=2C=CC(=O)NC2
Synonyms:
  • 5-[3-(Hydroxymethyl)phenyl]-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 5-[3-(hydroxymethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.