CymitQuimica logo

CAS 1111102-83-0

:

3-(1,6-Dihydro-6-oxo-3-pyridinyl)benzaldehyde

Description:
3-(1,6-Dihydro-6-oxo-3-pyridinyl)benzaldehyde is an organic compound characterized by its structure, which features a benzaldehyde moiety attached to a pyridine ring. The presence of the 1,6-dihydro-6-oxo group indicates that the compound contains a pyridine derivative with a ketone functionality, contributing to its reactivity and potential biological activity. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for pharmaceutical applications due to its heterocyclic structure. The molecular interactions of this compound can be influenced by the electron-withdrawing nature of the aldehyde group and the electron-donating characteristics of the pyridine nitrogen. Additionally, it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Its solubility and stability can vary depending on the solvent and environmental conditions. Overall, 3-(1,6-Dihydro-6-oxo-3-pyridinyl)benzaldehyde represents a versatile structure in organic chemistry with potential applications in medicinal chemistry and material science.
Formula:C12H9NO2
InChI:InChI=1S/C12H9NO2/c14-8-9-2-1-3-10(6-9)11-4-5-12(15)13-7-11/h1-8H,(H,13,15)
InChI key:InChIKey=OZPNQINZHJCEAY-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(C=CC1)C=2C=CC(=O)NC2
Synonyms:
  • Benzaldehyde, 3-(1,6-dihydro-6-oxo-3-pyridinyl)-
  • 3-(1,6-Dihydro-6-oxo-3-pyridinyl)benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.