
CAS 1111102-93-2
:5-(5-Chloro-2-methoxyphenyl)-2(1H)-pyridinone
Description:
5-(5-Chloro-2-methoxyphenyl)-2(1H)-pyridinone, identified by its CAS number 1111102-93-2, is a chemical compound that features a pyridinone core substituted with a chloro and a methoxy group. This compound typically exhibits characteristics common to heterocyclic compounds, including potential biological activity due to its structural motifs. The presence of the chloro group can influence its reactivity and solubility, while the methoxy group may enhance lipophilicity, affecting its pharmacokinetic properties. The compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as derivatives of pyridinones are often explored for their therapeutic effects. Additionally, its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, the unique combination of functional groups in this compound may contribute to its specific interactions in biological systems, warranting further investigation into its properties and potential applications.
Formula:C12H10ClNO2
InChI:InChI=1S/C12H10ClNO2/c1-16-11-4-3-9(13)6-10(11)8-2-5-12(15)14-7-8/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=WDBDBWFSZMLULZ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(Cl)C=C1)C=2C=CC(=O)NC2
Synonyms:- 5-(5-Chloro-2-methoxyphenyl)-2(1H)-pyridinone
- 2(1H)-Pyridinone, 5-(5-chloro-2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.