CymitQuimica logo

CAS 1111103-66-2

:

5-(3,4-Dimethoxyphenyl)-2(1H)-pyrimidinone

Description:
5-(3,4-Dimethoxyphenyl)-2(1H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core structure, which features a pyrimidine ring substituted with a 3,4-dimethoxyphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of methoxy groups on the phenyl ring can influence its electronic properties, potentially enhancing its reactivity and interactions with biological targets. Such compounds may exhibit pharmacological activities, making them of interest in medicinal chemistry. The molecular structure suggests potential for hydrogen bonding and π-π stacking interactions, which could be relevant in drug design and development. Additionally, the compound's specific characteristics, such as melting point, boiling point, and spectral properties, would depend on its purity and the conditions under which it is analyzed. Overall, 5-(3,4-Dimethoxyphenyl)-2(1H)-pyrimidinone represents a class of compounds that may have diverse applications in research and pharmaceuticals.
Formula:C12H12N2O3
InChI:InChI=1S/C12H12N2O3/c1-16-10-4-3-8(5-11(10)17-2)9-6-13-12(15)14-7-9/h3-7H,1-2H3,(H,13,14,15)
InChI key:InChIKey=PYIOOQKMECWMIP-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1OC)C2=CNC(=O)N=C2
Synonyms:
  • 2(1H)-Pyrimidinone, 5-(3,4-dimethoxyphenyl)-
  • 5-(3,4-Dimethoxyphenyl)-2(1H)-pyrimidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.