CymitQuimica logo

CAS 1111103-72-0

:

5-(2-Methoxy-5-methylphenyl)-2(1H)-pyrimidinone

Description:
5-(2-Methoxy-5-methylphenyl)-2(1H)-pyrimidinone is an organic compound characterized by its pyrimidinone core, which features a pyrimidine ring substituted with a phenyl group that has a methoxy and a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the methoxy group can influence its reactivity and polarity, while the methyl substitution may affect its steric properties and overall molecular interactions. Such compounds often find applications in medicinal chemistry due to their potential biological activity, including roles as enzyme inhibitors or in other therapeutic contexts. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or detailed literature references for precise values. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly in the realm of pharmaceuticals and agrochemicals.
Formula:C12H12N2O2
InChI:InChI=1S/C12H12N2O2/c1-8-3-4-11(16-2)10(5-8)9-6-13-12(15)14-7-9/h3-7H,1-2H3,(H,13,14,15)
InChI key:InChIKey=NKWRIGUKWPBCHP-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(C)C=C1)C2=CNC(=O)N=C2
Synonyms:
  • 5-(2-Methoxy-5-methylphenyl)-2(1H)-pyrimidinone
  • 2(1H)-Pyrimidinone, 5-(2-methoxy-5-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.